C14H21BrO3 — CID 79837541
1-(4-bromo-2-methylbutan-2-yl)-2,3,4-trimethoxybenzene (PubChem CID 79837541) has the molecular formula C14H21BrO3 and a molecular weight of 317.22 g/mol. Its IUPAC name is 1-(4-bromo-2-methylbutan-2-yl)-2,3,4-trimethoxybenzene.
| Compound Name | 1-(4-bromo-2-methylbutan-2-yl)-2,3,4-trimethoxybenzene |
|---|---|
| PubChem CID | 79837541 |
| Molecular Formula | C14H21BrO3 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 1-(4-bromo-2-methylbutan-2-yl)-2,3,4-trimethoxybenzene |
| SMILES | COc1ccc(C(C)(C)CCBr)c(OC)c1OC |
| InChI | InChI=1S/C14H21BrO3/c1-14(2,8-9-15)10-6-7-11(16-3)13(18-5)12(10)17-4/h6-7H,8-9H2,1-5H3 |
| InChIKey | QVCHFYLFOTUBTQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|