C13H17NO5 — CID 70447314
2,2-dimethoxy-2-(2,3,4-trimethoxyphenyl)acetonitrile (PubChem CID 70447314) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is 2,2-dimethoxy-2-(2,3,4-trimethoxyphenyl)acetonitrile.
| Compound Name | 2,2-dimethoxy-2-(2,3,4-trimethoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 70447314 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2,2-dimethoxy-2-(2,3,4-trimethoxyphenyl)acetonitrile |
| SMILES | COc1ccc(C(C#N)(OC)OC)c(OC)c1OC |
| InChI | InChI=1S/C13H17NO5/c1-15-10-7-6-9(11(16-2)12(10)17-3)13(8-14,18-4)19-5/h6-7H,1-5H3 |
| InChIKey | IJESFIDTXLTSJX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 69.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|