C28H48N2O3 — CID 177443653
(2R)-5-[decyl(methyl)amino]-2-propan-2-yl-2-(2,3,4-trimethoxyphenyl)pentanenitrile (PubChem CID 177443653) has the molecular formula C28H48N2O3 and a molecular weight of 460.70 g/mol. Its IUPAC name is (2R)-5-[decyl(methyl)amino]-2-propan-2-yl-2-(2,3,4-trimethoxyphenyl)pentanenitrile.
| Compound Name | (2R)-5-[decyl(methyl)amino]-2-propan-2-yl-2-(2,3,4-trimethoxyphenyl)pentanenitrile |
|---|---|
| PubChem CID | 177443653 |
| Molecular Formula | C28H48N2O3 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.37 |
| IUPAC Name | (2R)-5-[decyl(methyl)amino]-2-propan-2-yl-2-(2,3,4-trimethoxyphenyl)pentanenitrile |
| SMILES | CCCCCCCCCCN(C)CCC[C@](C#N)(c1ccc(OC)c(OC)c1OC)C(C)C |
| InChI | InChI=1S/C28H48N2O3/c1-8-9-10-11-12-13-14-15-20-30(4)21-16-19-28(22-29,23(2)3)24-17-18-25(31-5)27(33-7)26(24)32-6/h17-18,23H,8-16,19-21H2,1-7H3/t28-/m1/s1 |
| InChIKey | XRNCPJPTWJUPBD-MUUNZHRXSA-N |
| XLogP | 6.98 |
| TPSA | 54.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|