C15H24BrNO — CID 115262570
N-(bromomethyl)-2-(2-methoxy-4-propan-2-ylphenyl)-2-methylpropan-1-amine (PubChem CID 115262570) has the molecular formula C15H24BrNO and a molecular weight of 314.27 g/mol. Its IUPAC name is N-(bromomethyl)-2-(2-methoxy-4-propan-2-ylphenyl)-2-methylpropan-1-amine.
| Compound Name | N-(bromomethyl)-2-(2-methoxy-4-propan-2-ylphenyl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 115262570 |
| Molecular Formula | C15H24BrNO |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | N-(bromomethyl)-2-(2-methoxy-4-propan-2-ylphenyl)-2-methylpropan-1-amine |
| SMILES | COc1cc(C(C)C)ccc1C(C)(C)CNCBr |
| InChI | InChI=1S/C15H24BrNO/c1-11(2)12-6-7-13(14(8-12)18-5)15(3,4)9-17-10-16/h6-8,11,17H,9-10H2,1-5H3 |
| InChIKey | CBBAGYLKGNIQQQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|