C9H12Cl2N2O — CID 115226587
N'-(2,3-dichloro-4-methoxyphenyl)-N-methylmethanediamine (PubChem CID 115226587) has the molecular formula C9H12Cl2N2O and a molecular weight of 235.11 g/mol. Its IUPAC name is N'-(2,3-dichloro-4-methoxyphenyl)-N-methylmethanediamine.
| Compound Name | N'-(2,3-dichloro-4-methoxyphenyl)-N-methylmethanediamine |
|---|---|
| PubChem CID | 115226587 |
| Molecular Formula | C9H12Cl2N2O |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | N'-(2,3-dichloro-4-methoxyphenyl)-N-methylmethanediamine |
| SMILES | CNCNc1ccc(OC)c(Cl)c1Cl |
| InChI | InChI=1S/C9H12Cl2N2O/c1-12-5-13-6-3-4-7(14-2)9(11)8(6)10/h3-4,12-13H,5H2,1-2H3 |
| InChIKey | KIWSWLOWHDSSTG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|