C11H16Cl2N2O — CID 115227073
N'-[(2,3-dichloro-4-methoxyphenyl)methyl]-N,N'-dimethylmethanediamine (PubChem CID 115227073) has the molecular formula C11H16Cl2N2O and a molecular weight of 263.17 g/mol. Its IUPAC name is N'-[(2,3-dichloro-4-methoxyphenyl)methyl]-N,N'-dimethylmethanediamine.
| Compound Name | N'-[(2,3-dichloro-4-methoxyphenyl)methyl]-N,N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 115227073 |
| Molecular Formula | C11H16Cl2N2O |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | N'-[(2,3-dichloro-4-methoxyphenyl)methyl]-N,N'-dimethylmethanediamine |
| SMILES | CNCN(C)Cc1ccc(OC)c(Cl)c1Cl |
| InChI | InChI=1S/C11H16Cl2N2O/c1-14-7-15(2)6-8-4-5-9(16-3)11(13)10(8)12/h4-5,14H,6-7H2,1-3H3 |
| InChIKey | BDZFEWJFOQMTKK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|