C10H9Cl2NO3 — CID 115166291
N-[(2,3-dichloro-4-methoxyphenyl)methyl]-2-oxoacetamide (PubChem CID 115166291) has the molecular formula C10H9Cl2NO3 and a molecular weight of 262.09 g/mol. Its IUPAC name is N-[(2,3-dichloro-4-methoxyphenyl)methyl]-2-oxoacetamide.
| Compound Name | N-[(2,3-dichloro-4-methoxyphenyl)methyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 115166291 |
| Molecular Formula | C10H9Cl2NO3 |
| Molecular Weight | 262.09 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | N-[(2,3-dichloro-4-methoxyphenyl)methyl]-2-oxoacetamide |
| SMILES | COc1ccc(CNC(=O)C=O)c(Cl)c1Cl |
| InChI | InChI=1S/C10H9Cl2NO3/c1-16-7-3-2-6(9(11)10(7)12)4-13-8(15)5-14/h2-3,5H,4H2,1H3,(H,13,15) |
| InChIKey | AYLVVRHQAHQCFG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.09 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|