C9H8Cl2O3 — CID 72942143
methyl 2,6-dichloro-3-methoxybenzoate (PubChem CID 72942143) has the molecular formula C9H8Cl2O3 and a molecular weight of 235.07 g/mol. Its IUPAC name is methyl 2,6-dichloro-3-methoxybenzoate.
| Compound Name | methyl 2,6-dichloro-3-methoxybenzoate |
|---|---|
| PubChem CID | 72942143 |
| Molecular Formula | C9H8Cl2O3 |
| Molecular Weight | 235.07 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | methyl 2,6-dichloro-3-methoxybenzoate |
| SMILES | COC(=O)c1c(Cl)ccc(OC)c1Cl |
| InChI | InChI=1S/C9H8Cl2O3/c1-13-6-4-3-5(10)7(8(6)11)9(12)14-2/h3-4H,1-2H3 |
| InChIKey | JNVDRHPOEZWRHN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.07 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |