methyl 2,6-dichloro-3-(2-pyrrolidin-1-ylethoxy)benzoate

C14H17Cl2NO3 — CID 54055500

IUPACmethyl 2,6-dichloro-3-(2-pyrrolidin-1-ylethoxy)benzoate
SMILESCOC(=O)c1c(Cl)ccc(OCCN2CCCC2)c1Cl
InChIInChI=1S/C14H17Cl2NO3/c1-19-14(18)12-10(15)4-5-11(13(12)16)20-9-8-17-6-2-3-7-17/h4-5H,2-3,6-9H2,1H3
InChIKeyLVYMUKXHKXSOMX-UHFFFAOYSA-N
MW318.20 g/mol
LogP3.25
Rot. Bonds5

About methyl 2,6-dichloro-3-(2-pyrrolidin-1-ylethoxy)benzoate

methyl 2,6-dichloro-3-(2-pyrrolidin-1-ylethoxy)benzoate (PubChem CID 54055500) has the molecular formula C14H17Cl2NO3 and a molecular weight of 318.20 g/mol. Its IUPAC name is methyl 2,6-dichloro-3-(2-pyrrolidin-1-ylethoxy)benzoate.

Molecular Properties

Compound Namemethyl 2,6-dichloro-3-(2-pyrrolidin-1-ylethoxy)benzoate
PubChem CID54055500
Molecular FormulaC14H17Cl2NO3
Molecular Weight318.20 g/mol
Exact Mass317.06
IUPAC Namemethyl 2,6-dichloro-3-(2-pyrrolidin-1-ylethoxy)benzoate
SMILESCOC(=O)c1c(Cl)ccc(OCCN2CCCC2)c1Cl
InChIInChI=1S/C14H17Cl2NO3/c1-19-14(18)12-10(15)4-5-11(13(12)16)20-9-8-17-6-2-3-7-17/h4-5H,2-3,6-9H2,1H3
InChIKeyLVYMUKXHKXSOMX-UHFFFAOYSA-N
XLogP3.25
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.20
LogP ≤ 53.25
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2,6-dichloro-3-(2-pyrrolidin-1-ylethoxy)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,6-dichloro-3-(2-pyrrolidin-1-ylethoxy)benzoate?
The IUPAC name of methyl 2,6-dichloro-3-(2-pyrrolidin-1-ylethoxy)benzoate (CID 54055500) is methyl 2,6-dichloro-3-(2-pyrrolidin-1-ylethoxy)benzoate.
What is the SMILES notation for methyl 2,6-dichloro-3-(2-pyrrolidin-1-ylethoxy)benzoate?
The canonical SMILES for methyl 2,6-dichloro-3-(2-pyrrolidin-1-ylethoxy)benzoate is COC(=O)c1c(Cl)ccc(OCCN2CCCC2)c1Cl.
What is the InChIKey of methyl 2,6-dichloro-3-(2-pyrrolidin-1-ylethoxy)benzoate?
The InChIKey is LVYMUKXHKXSOMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17Cl2NO3/c1-19-14(18)12-10(15)4-5-11(13(12)16)20-9-8-17-6-2-3-7-17/h4-5H,2-3,6-9H2,1H3.
What are the key properties of methyl 2,6-dichloro-3-(2-pyrrolidin-1-ylethoxy)benzoate?
methyl 2,6-dichloro-3-(2-pyrrolidin-1-ylethoxy)benzoate has a molecular weight of 318.20 g/mol, XLogP of 3.25, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,6-dichloro-3-(2-pyrrolidin-1-ylethoxy)benzoate is sourced from PubChem (CID 54055500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).