C25H29Cl2N3O2 — CID 20553485
4,5-dichloro-3,6-bis(2-pyrrolidin-1-ylethoxy)acridine (PubChem CID 20553485) has the molecular formula C25H29Cl2N3O2 and a molecular weight of 474.43 g/mol. Its IUPAC name is 4,5-dichloro-3,6-bis(2-pyrrolidin-1-ylethoxy)acridine.
| Compound Name | 4,5-dichloro-3,6-bis(2-pyrrolidin-1-ylethoxy)acridine |
|---|---|
| PubChem CID | 20553485 |
| Molecular Formula | C25H29Cl2N3O2 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 4,5-dichloro-3,6-bis(2-pyrrolidin-1-ylethoxy)acridine |
| SMILES | Clc1c(OCCN2CCCC2)ccc2cc3ccc(OCCN4CCCC4)c(Cl)c3nc12 |
| InChI | InChI=1S/C25H29Cl2N3O2/c26-22-20(31-15-13-29-9-1-2-10-29)7-5-18-17-19-6-8-21(23(27)25(19)28-24(18)22)32-16-14-30-11-3-4-12-30/h5-8,17H,1-4,9-16H2 |
| InChIKey | JMZFZTAPTFKZKW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|