C27H33Br2N3O2 — CID 20553499
4,5-dibromo-3,6-bis(2-piperidin-1-ylethoxy)acridine (PubChem CID 20553499) has the molecular formula C27H33Br2N3O2 and a molecular weight of 591.39 g/mol. Its IUPAC name is 4,5-dibromo-3,6-bis(2-piperidin-1-ylethoxy)acridine.
| Compound Name | 4,5-dibromo-3,6-bis(2-piperidin-1-ylethoxy)acridine |
|---|---|
| PubChem CID | 20553499 |
| Molecular Formula | C27H33Br2N3O2 |
| Molecular Weight | 591.39 g/mol |
| Exact Mass | 589.09 |
| IUPAC Name | 4,5-dibromo-3,6-bis(2-piperidin-1-ylethoxy)acridine |
| SMILES | Brc1c(OCCN2CCCCC2)ccc2cc3ccc(OCCN4CCCCC4)c(Br)c3nc12 |
| InChI | InChI=1S/C27H33Br2N3O2/c28-24-22(33-17-15-31-11-3-1-4-12-31)9-7-20-19-21-8-10-23(25(29)27(21)30-26(20)24)34-18-16-32-13-5-2-6-14-32/h7-10,19H,1-6,11-18H2 |
| InChIKey | OWNCLLXTTBDKRF-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.39 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|