C27H35Br2N3O2 — CID 70449102
3,5-dibromo-3,6-bis(2-piperidin-1-ylethoxy)-4H-acridine (PubChem CID 70449102) has the molecular formula C27H35Br2N3O2 and a molecular weight of 593.40 g/mol. Its IUPAC name is 3,5-dibromo-3,6-bis(2-piperidin-1-ylethoxy)-4H-acridine.
| Compound Name | 3,5-dibromo-3,6-bis(2-piperidin-1-ylethoxy)-4H-acridine |
|---|---|
| PubChem CID | 70449102 |
| Molecular Formula | C27H35Br2N3O2 |
| Molecular Weight | 593.40 g/mol |
| Exact Mass | 591.11 |
| IUPAC Name | 3,5-dibromo-3,6-bis(2-piperidin-1-ylethoxy)-4H-acridine |
| SMILES | Brc1c(OCCN2CCCCC2)ccc2cc3c(nc12)CC(Br)(OCCN1CCCCC1)C=C3 |
| InChI | InChI=1S/C27H35Br2N3O2/c28-25-24(33-17-15-31-11-3-1-4-12-31)8-7-22-19-21-9-10-27(29,20-23(21)30-26(22)25)34-18-16-32-13-5-2-6-14-32/h7-10,19H,1-6,11-18,20H2 |
| InChIKey | XPUOARWXCKKIBW-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.40 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|