C9H9Cl2NO3 — CID 115170906
(2,3-dichloro-4-methoxyphenyl)methylcarbamic acid (PubChem CID 115170906) has the molecular formula C9H9Cl2NO3 and a molecular weight of 250.08 g/mol. Its IUPAC name is (2,3-dichloro-4-methoxyphenyl)methylcarbamic acid.
| Compound Name | (2,3-dichloro-4-methoxyphenyl)methylcarbamic acid |
|---|---|
| PubChem CID | 115170906 |
| Molecular Formula | C9H9Cl2NO3 |
| Molecular Weight | 250.08 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | (2,3-dichloro-4-methoxyphenyl)methylcarbamic acid |
| SMILES | COc1ccc(CNC(=O)O)c(Cl)c1Cl |
| InChI | InChI=1S/C9H9Cl2NO3/c1-15-6-3-2-5(4-12-9(13)14)7(10)8(6)11/h2-3,12H,4H2,1H3,(H,13,14) |
| InChIKey | MRURIFKNGSTPNE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.08 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |