C11H13Cl2NO2 — CID 115191205
N-[(2,3-dichloro-4-methoxyphenyl)methyl]-N-methylacetamide (PubChem CID 115191205) has the molecular formula C11H13Cl2NO2 and a molecular weight of 262.14 g/mol. Its IUPAC name is N-[(2,3-dichloro-4-methoxyphenyl)methyl]-N-methylacetamide.
| Compound Name | N-[(2,3-dichloro-4-methoxyphenyl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 115191205 |
| Molecular Formula | C11H13Cl2NO2 |
| Molecular Weight | 262.14 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | N-[(2,3-dichloro-4-methoxyphenyl)methyl]-N-methylacetamide |
| SMILES | COc1ccc(CN(C)C(C)=O)c(Cl)c1Cl |
| InChI | InChI=1S/C11H13Cl2NO2/c1-7(15)14(2)6-8-4-5-9(16-3)11(13)10(8)12/h4-5H,6H2,1-3H3 |
| InChIKey | GSMJNEZVDPKIEV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.14 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |