C19H19Cl2NO4 — CID 99996164
(E)-3-(2,4-dichlorophenyl)-N-[(2,3,4-trimethoxyphenyl)methyl]prop-2-enamide (PubChem CID 99996164) has the molecular formula C19H19Cl2NO4 and a molecular weight of 396.27 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-[(2,3,4-trimethoxyphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-[(2,3,4-trimethoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 99996164 |
| Molecular Formula | C19H19Cl2NO4 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-[(2,3,4-trimethoxyphenyl)methyl]prop-2-enamide |
| SMILES | COc1ccc(CNC(=O)/C=C/c2ccc(Cl)cc2Cl)c(OC)c1OC |
| InChI | InChI=1S/C19H19Cl2NO4/c1-24-16-8-5-13(18(25-2)19(16)26-3)11-22-17(23)9-6-12-4-7-14(20)10-15(12)21/h4-10H,11H2,1-3H3,(H,22,23)/b9-6+ |
| InChIKey | LZFKTMWUUJCMNQ-RMKNXTFCSA-N |
| XLogP | 4.35 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|