C10H12BrCl2NO — CID 115262285
N-(bromomethyl)-2-(2,3-dichloro-4-methoxyphenyl)ethanamine (PubChem CID 115262285) has the molecular formula C10H12BrCl2NO and a molecular weight of 313.02 g/mol. Its IUPAC name is N-(bromomethyl)-2-(2,3-dichloro-4-methoxyphenyl)ethanamine.
| Compound Name | N-(bromomethyl)-2-(2,3-dichloro-4-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 115262285 |
| Molecular Formula | C10H12BrCl2NO |
| Molecular Weight | 313.02 g/mol |
| Exact Mass | 310.95 |
| IUPAC Name | N-(bromomethyl)-2-(2,3-dichloro-4-methoxyphenyl)ethanamine |
| SMILES | COc1ccc(CCNCBr)c(Cl)c1Cl |
| InChI | InChI=1S/C10H12BrCl2NO/c1-15-8-3-2-7(4-5-14-6-11)9(12)10(8)13/h2-3,14H,4-6H2,1H3 |
| InChIKey | PFMMCYORUFGTLJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.02 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|