C11H12ClNO3 — CID 115166223
N-[(5-chloro-4-methoxy-2-methylphenyl)methyl]-2-oxoacetamide (PubChem CID 115166223) has the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. Its IUPAC name is N-[(5-chloro-4-methoxy-2-methylphenyl)methyl]-2-oxoacetamide.
| Compound Name | N-[(5-chloro-4-methoxy-2-methylphenyl)methyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 115166223 |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 241.67 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | N-[(5-chloro-4-methoxy-2-methylphenyl)methyl]-2-oxoacetamide |
| SMILES | COc1cc(C)c(CNC(=O)C=O)cc1Cl |
| InChI | InChI=1S/C11H12ClNO3/c1-7-3-10(16-2)9(12)4-8(7)5-13-11(15)6-14/h3-4,6H,5H2,1-2H3,(H,13,15) |
| InChIKey | FQYRHMGDSBXVMB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.67 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|