C12H19NO3 — CID 115258433
2,4-dimethoxy-N-(methoxymethyl)-N,6-dimethylaniline (PubChem CID 115258433) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 2,4-dimethoxy-N-(methoxymethyl)-N,6-dimethylaniline.
| Compound Name | 2,4-dimethoxy-N-(methoxymethyl)-N,6-dimethylaniline |
|---|---|
| PubChem CID | 115258433 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 2,4-dimethoxy-N-(methoxymethyl)-N,6-dimethylaniline |
| SMILES | COCN(C)c1c(C)cc(OC)cc1OC |
| InChI | InChI=1S/C12H19NO3/c1-9-6-10(15-4)7-11(16-5)12(9)13(2)8-14-3/h6-7H,8H2,1-5H3 |
| InChIKey | BSXFUEHVGFUBAW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|