C13H22N2O3 — CID 115120475
2-amino-3-(2,4-dimethoxy-N,6-dimethylanilino)propan-1-ol (PubChem CID 115120475) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-amino-3-(2,4-dimethoxy-N,6-dimethylanilino)propan-1-ol.
| Compound Name | 2-amino-3-(2,4-dimethoxy-N,6-dimethylanilino)propan-1-ol |
|---|---|
| PubChem CID | 115120475 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 2-amino-3-(2,4-dimethoxy-N,6-dimethylanilino)propan-1-ol |
| SMILES | COc1cc(C)c(N(C)CC(N)CO)c(OC)c1 |
| InChI | InChI=1S/C13H22N2O3/c1-9-5-11(17-3)6-12(18-4)13(9)15(2)7-10(14)8-16/h5-6,10,16H,7-8,14H2,1-4H3 |
| InChIKey | PBBQEAGJURZYEY-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|