C14H24N2O2 — CID 115120488
2-amino-3-(4-methoxy-N,2,3,6-tetramethylanilino)propan-1-ol (PubChem CID 115120488) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-amino-3-(4-methoxy-N,2,3,6-tetramethylanilino)propan-1-ol.
| Compound Name | 2-amino-3-(4-methoxy-N,2,3,6-tetramethylanilino)propan-1-ol |
|---|---|
| PubChem CID | 115120488 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 2-amino-3-(4-methoxy-N,2,3,6-tetramethylanilino)propan-1-ol |
| SMILES | COc1cc(C)c(N(C)CC(N)CO)c(C)c1C |
| InChI | InChI=1S/C14H24N2O2/c1-9-6-13(18-5)10(2)11(3)14(9)16(4)7-12(15)8-17/h6,12,17H,7-8,15H2,1-5H3 |
| InChIKey | WYCBBVCSBUHJOC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|