N-(2,4-dimethoxy-6-methylphenyl)-N-methylcarbamoyl chloride

C11H14ClNO3 — CID 115194561

IUPACN-(2,4-dimethoxy-6-methylphenyl)-N-methylcarbamoyl chloride
SMILESCOc1cc(C)c(N(C)C(=O)Cl)c(OC)c1
InChIInChI=1S/C11H14ClNO3/c1-7-5-8(15-3)6-9(16-4)10(7)13(2)11(12)14/h5-6H,1-4H3
InChIKeyJULNMAUSNAHVTE-UHFFFAOYSA-N
MW243.69 g/mol
LogP2.81
Rot. Bonds3

About N-(2,4-dimethoxy-6-methylphenyl)-N-methylcarbamoyl chloride

N-(2,4-dimethoxy-6-methylphenyl)-N-methylcarbamoyl chloride (PubChem CID 115194561) has the molecular formula C11H14ClNO3 and a molecular weight of 243.69 g/mol. Its IUPAC name is N-(2,4-dimethoxy-6-methylphenyl)-N-methylcarbamoyl chloride.

Molecular Properties

Compound NameN-(2,4-dimethoxy-6-methylphenyl)-N-methylcarbamoyl chloride
PubChem CID115194561
Molecular FormulaC11H14ClNO3
Molecular Weight243.69 g/mol
Exact Mass243.07
IUPAC NameN-(2,4-dimethoxy-6-methylphenyl)-N-methylcarbamoyl chloride
SMILESCOc1cc(C)c(N(C)C(=O)Cl)c(OC)c1
InChIInChI=1S/C11H14ClNO3/c1-7-5-8(15-3)6-9(16-4)10(7)13(2)11(12)14/h5-6H,1-4H3
InChIKeyJULNMAUSNAHVTE-UHFFFAOYSA-N
XLogP2.81
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.69
LogP ≤ 52.81
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze N-(2,4-dimethoxy-6-methylphenyl)-N-methylcarbamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(2,4-dimethoxy-6-methylphenyl)-N-methylcarbamoyl chloride?
The IUPAC name of N-(2,4-dimethoxy-6-methylphenyl)-N-methylcarbamoyl chloride (CID 115194561) is N-(2,4-dimethoxy-6-methylphenyl)-N-methylcarbamoyl chloride.
What is the SMILES notation for N-(2,4-dimethoxy-6-methylphenyl)-N-methylcarbamoyl chloride?
The canonical SMILES for N-(2,4-dimethoxy-6-methylphenyl)-N-methylcarbamoyl chloride is COc1cc(C)c(N(C)C(=O)Cl)c(OC)c1.
What is the InChIKey of N-(2,4-dimethoxy-6-methylphenyl)-N-methylcarbamoyl chloride?
The InChIKey is JULNMAUSNAHVTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClNO3/c1-7-5-8(15-3)6-9(16-4)10(7)13(2)11(12)14/h5-6H,1-4H3.
What are the key properties of N-(2,4-dimethoxy-6-methylphenyl)-N-methylcarbamoyl chloride?
N-(2,4-dimethoxy-6-methylphenyl)-N-methylcarbamoyl chloride has a molecular weight of 243.69 g/mol, XLogP of 2.81, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-dimethoxy-6-methylphenyl)-N-methylcarbamoyl chloride is sourced from PubChem (CID 115194561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).