C15H23NO2 — CID 115236337
5-(4-methoxy-N,2,5-trimethylanilino)pentan-2-one (PubChem CID 115236337) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 5-(4-methoxy-N,2,5-trimethylanilino)pentan-2-one.
| Compound Name | 5-(4-methoxy-N,2,5-trimethylanilino)pentan-2-one |
|---|---|
| PubChem CID | 115236337 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 5-(4-methoxy-N,2,5-trimethylanilino)pentan-2-one |
| SMILES | COc1cc(C)c(N(C)CCCC(C)=O)cc1C |
| InChI | InChI=1S/C15H23NO2/c1-11-10-15(18-5)12(2)9-14(11)16(4)8-6-7-13(3)17/h9-10H,6-8H2,1-5H3 |
| InChIKey | KLFSHPIKNLUHMG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|