C14H23NO3 — CID 115217502
4-(2,5-dimethoxy-N,4-dimethylanilino)butan-1-ol (PubChem CID 115217502) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 4-(2,5-dimethoxy-N,4-dimethylanilino)butan-1-ol.
| Compound Name | 4-(2,5-dimethoxy-N,4-dimethylanilino)butan-1-ol |
|---|---|
| PubChem CID | 115217502 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 4-(2,5-dimethoxy-N,4-dimethylanilino)butan-1-ol |
| SMILES | COc1cc(N(C)CCCCO)c(OC)cc1C |
| InChI | InChI=1S/C14H23NO3/c1-11-9-14(18-4)12(10-13(11)17-3)15(2)7-5-6-8-16/h9-10,16H,5-8H2,1-4H3 |
| InChIKey | RNUMASZEXBQWIJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|