C13H21NO2 — CID 59791351
N,N-diethyl-2,5-dimethoxy-4-methylaniline (PubChem CID 59791351) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is N,N-diethyl-2,5-dimethoxy-4-methylaniline.
| Compound Name | N,N-diethyl-2,5-dimethoxy-4-methylaniline |
|---|---|
| PubChem CID | 59791351 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | N,N-diethyl-2,5-dimethoxy-4-methylaniline |
| SMILES | CCN(CC)c1cc(OC)c(C)cc1OC |
| InChI | InChI=1S/C13H21NO2/c1-6-14(7-2)11-9-12(15-4)10(3)8-13(11)16-5/h8-9H,6-7H2,1-5H3 |
| InChIKey | FLQIIULCWJERJT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |