C11H17BrN2O — CID 169490482
2-bromo-1-N,1-N-diethyl-5-methoxybenzene-1,4-diamine (PubChem CID 169490482) has the molecular formula C11H17BrN2O and a molecular weight of 273.17 g/mol. Its IUPAC name is 2-bromo-1-N,1-N-diethyl-5-methoxybenzene-1,4-diamine.
| Compound Name | 2-bromo-1-N,1-N-diethyl-5-methoxybenzene-1,4-diamine |
|---|---|
| PubChem CID | 169490482 |
| Molecular Formula | C11H17BrN2O |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 2-bromo-1-N,1-N-diethyl-5-methoxybenzene-1,4-diamine |
| SMILES | CCN(CC)c1cc(OC)c(N)cc1Br |
| InChI | InChI=1S/C11H17BrN2O/c1-4-14(5-2)10-7-11(15-3)9(13)6-8(10)12/h6-7H,4-5,13H2,1-3H3 |
| InChIKey | HBAITGOVAKASOB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|