C18H31BrN2O2 — CID 20979596
2-bromo-N,N-diethyl-4,5-dimethoxyaniline;N-methylcyclopentanamine (PubChem CID 20979596) has the molecular formula C18H31BrN2O2 and a molecular weight of 387.36 g/mol. Its IUPAC name is 2-bromo-N,N-diethyl-4,5-dimethoxyaniline;N-methylcyclopentanamine.
| Compound Name | 2-bromo-N,N-diethyl-4,5-dimethoxyaniline;N-methylcyclopentanamine |
|---|---|
| PubChem CID | 20979596 |
| Molecular Formula | C18H31BrN2O2 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2-bromo-N,N-diethyl-4,5-dimethoxyaniline;N-methylcyclopentanamine |
| SMILES | CCN(CC)c1cc(OC)c(OC)cc1Br.CNC1CCCC1 |
| InChI | InChI=1S/C12H18BrNO2.C6H13N/c1-5-14(6-2)10-8-12(16-4)11(15-3)7-9(10)13;1-7-6-4-2-3-5-6/h7-8H,5-6H2,1-4H3;6-7H,2-5H2,1H3 |
| InChIKey | CTHBBZZHSBSLEW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|