C9H13ClN2O — CID 54032840
2-chloro-5-methoxy-1-N,1-N-dimethylbenzene-1,4-diamine (PubChem CID 54032840) has the molecular formula C9H13ClN2O and a molecular weight of 200.67 g/mol. Its IUPAC name is 2-chloro-5-methoxy-1-N,1-N-dimethylbenzene-1,4-diamine.
| Compound Name | 2-chloro-5-methoxy-1-N,1-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 54032840 |
| Molecular Formula | C9H13ClN2O |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 2-chloro-5-methoxy-1-N,1-N-dimethylbenzene-1,4-diamine |
| SMILES | COc1cc(N(C)C)c(Cl)cc1N |
| InChI | InChI=1S/C9H13ClN2O/c1-12(2)8-5-9(13-3)7(11)4-6(8)10/h4-5H,11H2,1-3H3 |
| InChIKey | LGVGNLIRZYERDG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|