C16H19ClN2O3 — CID 66998862
2-chloro-5-(2,3-dimethoxyphenoxy)-1-N,1-N-dimethylbenzene-1,4-diamine (PubChem CID 66998862) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is 2-chloro-5-(2,3-dimethoxyphenoxy)-1-N,1-N-dimethylbenzene-1,4-diamine.
| Compound Name | 2-chloro-5-(2,3-dimethoxyphenoxy)-1-N,1-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 66998862 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2-chloro-5-(2,3-dimethoxyphenoxy)-1-N,1-N-dimethylbenzene-1,4-diamine |
| SMILES | COc1cccc(Oc2cc(N(C)C)c(Cl)cc2N)c1OC |
| InChI | InChI=1S/C16H19ClN2O3/c1-19(2)12-9-15(11(18)8-10(12)17)22-14-7-5-6-13(20-3)16(14)21-4/h5-9H,18H2,1-4H3 |
| InChIKey | WPPMPHVXAPWZOH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|