C9H10ClF3N2O — CID 66511544
4-[(1S)-1-amino-2,2,2-trifluoroethyl]-5-chloro-2-methoxyaniline (PubChem CID 66511544) has the molecular formula C9H10ClF3N2O and a molecular weight of 254.64 g/mol. Its IUPAC name is 4-[(1S)-1-amino-2,2,2-trifluoroethyl]-5-chloro-2-methoxyaniline.
| Compound Name | 4-[(1S)-1-amino-2,2,2-trifluoroethyl]-5-chloro-2-methoxyaniline |
|---|---|
| PubChem CID | 66511544 |
| Molecular Formula | C9H10ClF3N2O |
| Molecular Weight | 254.64 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 4-[(1S)-1-amino-2,2,2-trifluoroethyl]-5-chloro-2-methoxyaniline |
| SMILES | COc1cc([C@H](N)C(F)(F)F)c(Cl)cc1N |
| InChI | InChI=1S/C9H10ClF3N2O/c1-16-7-2-4(5(10)3-6(7)14)8(15)9(11,12)13/h2-3,8H,14-15H2,1H3/t8-/m0/s1 |
| InChIKey | LLEVQYRKLWRDNI-QMMMGPOBSA-N |
| XLogP | 2.49 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.64 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|