C9H8F5NO2 — CID 66511609
6-[(1R)-1-amino-2,2,2-trifluoroethyl]-2,3-difluoro-4-methoxyphenol (PubChem CID 66511609) has the molecular formula C9H8F5NO2 and a molecular weight of 257.16 g/mol. Its IUPAC name is 6-[(1R)-1-amino-2,2,2-trifluoroethyl]-2,3-difluoro-4-methoxyphenol.
| Compound Name | 6-[(1R)-1-amino-2,2,2-trifluoroethyl]-2,3-difluoro-4-methoxyphenol |
|---|---|
| PubChem CID | 66511609 |
| Molecular Formula | C9H8F5NO2 |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 6-[(1R)-1-amino-2,2,2-trifluoroethyl]-2,3-difluoro-4-methoxyphenol |
| SMILES | COc1cc([C@@H](N)C(F)(F)F)c(O)c(F)c1F |
| InChI | InChI=1S/C9H8F5NO2/c1-17-4-2-3(8(15)9(12,13)14)7(16)6(11)5(4)10/h2,8,16H,15H2,1H3/t8-/m1/s1 |
| InChIKey | NANAMAFDDOUMSW-MRVPVSSYSA-N |
| XLogP | 2.24 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|