C11H12Cl2N4O3 — CID 70633784
6-amino-1H-pyrimidine-2,4-dione;4,5-dichloro-2-methoxyaniline (PubChem CID 70633784) has the molecular formula C11H12Cl2N4O3 and a molecular weight of 319.15 g/mol. Its IUPAC name is 6-amino-1H-pyrimidine-2,4-dione;4,5-dichloro-2-methoxyaniline.
| Compound Name | 6-amino-1H-pyrimidine-2,4-dione;4,5-dichloro-2-methoxyaniline |
|---|---|
| PubChem CID | 70633784 |
| Molecular Formula | C11H12Cl2N4O3 |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 6-amino-1H-pyrimidine-2,4-dione;4,5-dichloro-2-methoxyaniline |
| SMILES | COc1cc(Cl)c(Cl)cc1N.Nc1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C7H7Cl2NO.C4H5N3O2/c1-11-7-3-5(9)4(8)2-6(7)10;5-2-1-3(8)7-4(9)6-2/h2-3H,10H2,1H3;1H,(H4,5,6,7,8,9) |
| InChIKey | ZFGBPBYCEOKKGM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 126.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|