C16H25N3O4 — CID 143527416
tert-butyl N-[2-(2-formamido-5-methoxy-N-methylanilino)ethyl]carbamate (PubChem CID 143527416) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is tert-butyl N-[2-(2-formamido-5-methoxy-N-methylanilino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-formamido-5-methoxy-N-methylanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 143527416 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | tert-butyl N-[2-(2-formamido-5-methoxy-N-methylanilino)ethyl]carbamate |
| SMILES | COc1ccc(NC=O)c(N(C)CCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C16H25N3O4/c1-16(2,3)23-15(21)17-8-9-19(4)14-10-12(22-5)6-7-13(14)18-11-20/h6-7,10-11H,8-9H2,1-5H3,(H,17,21)(H,18,20) |
| InChIKey | SXEGZYZWXFSGLK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|