C27H38N4O4 — CID 11799009
tert-butyl N-[2-[bis[2-[(3-methoxyphenyl)methylideneamino]ethyl]amino]ethyl]carbamate (PubChem CID 11799009) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is tert-butyl N-[2-[bis[2-[(3-methoxyphenyl)methylideneamino]ethyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[bis[2-[(3-methoxyphenyl)methylideneamino]ethyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 11799009 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | tert-butyl N-[2-[bis[2-[(3-methoxyphenyl)methylideneamino]ethyl]amino]ethyl]carbamate |
| SMILES | COc1cccc(/C=N/CCN(CC/N=C/c2cccc(OC)c2)CCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C27H38N4O4/c1-27(2,3)35-26(32)30-14-17-31(15-12-28-20-22-8-6-10-24(18-22)33-4)16-13-29-21-23-9-7-11-25(19-23)34-5/h6-11,18-21H,12-17H2,1-5H3,(H,30,32)/b28-20+,29-21+ |
| InChIKey | RRBIOSSIASAUQK-IABPKXMJSA-N |
| XLogP | 4.07 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|