C23H39N3O3 — CID 144646267
tert-butyl N-[2-[[3-(hexylcarbamoyl)phenyl]methylideneamino]ethyl]carbamate;ethane (PubChem CID 144646267) has the molecular formula C23H39N3O3 and a molecular weight of 405.58 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-(hexylcarbamoyl)phenyl]methylideneamino]ethyl]carbamate;ethane.
| Compound Name | tert-butyl N-[2-[[3-(hexylcarbamoyl)phenyl]methylideneamino]ethyl]carbamate;ethane |
|---|---|
| PubChem CID | 144646267 |
| Molecular Formula | C23H39N3O3 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.30 |
| IUPAC Name | tert-butyl N-[2-[[3-(hexylcarbamoyl)phenyl]methylideneamino]ethyl]carbamate;ethane |
| SMILES | CC.CCCCCCNC(=O)c1cccc(/C=N/CCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C21H33N3O3.C2H6/c1-5-6-7-8-12-23-19(25)18-11-9-10-17(15-18)16-22-13-14-24-20(26)27-21(2,3)4;1-2/h9-11,15-16H,5-8,12-14H2,1-4H3,(H,23,25)(H,24,26);1-2H3/b22-16+; |
| InChIKey | GJPCTGBKJZJVQO-YHLMHSEJSA-N |
| XLogP | 4.97 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|