C20H29N3O5 — CID 108918842
tert-butyl N-[2-[3-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]propylamino]-2-oxoethyl]carbamate (PubChem CID 108918842) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]propylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]propylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108918842 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | tert-butyl N-[2-[3-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]propylamino]-2-oxoethyl]carbamate |
| SMILES | COc1cccc(/C=C/C(=O)NCCCNC(=O)CNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C20H29N3O5/c1-20(2,3)28-19(26)23-14-18(25)22-12-6-11-21-17(24)10-9-15-7-5-8-16(13-15)27-4/h5,7-10,13H,6,11-12,14H2,1-4H3,(H,21,24)(H,22,25)(H,23,26)/b10-9+ |
| InChIKey | UDYOTJZPQKVKTJ-MDZDMXLPSA-N |
| XLogP | 1.86 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|