C24H29N3O5 — CID 108918615
tert-butyl N-[2-[3-[[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]methyl]anilino]-2-oxoethyl]carbamate (PubChem CID 108918615) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]methyl]anilino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]methyl]anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108918615 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | tert-butyl N-[2-[3-[[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]methyl]anilino]-2-oxoethyl]carbamate |
| SMILES | COc1cccc(/C=C/C(=O)NCc2cccc(NC(=O)CNC(=O)OC(C)(C)C)c2)c1 |
| InChI | InChI=1S/C24H29N3O5/c1-24(2,3)32-23(30)26-16-22(29)27-19-9-5-8-18(13-19)15-25-21(28)12-11-17-7-6-10-20(14-17)31-4/h5-14H,15-16H2,1-4H3,(H,25,28)(H,26,30)(H,27,29)/b12-11+ |
| InChIKey | KZNDBGQXTBEPQT-VAWYXSNFSA-N |
| XLogP | 3.49 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|