C16H25N3O2 — CID 170490406
tert-butyl N-[4-(4,5-diamino-2-methylphenyl)but-3-enyl]carbamate (PubChem CID 170490406) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is tert-butyl N-[4-(4,5-diamino-2-methylphenyl)but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[4-(4,5-diamino-2-methylphenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170490406 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | tert-butyl N-[4-(4,5-diamino-2-methylphenyl)but-3-enyl]carbamate |
| SMILES | Cc1cc(N)c(N)cc1C=CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25N3O2/c1-11-9-13(17)14(18)10-12(11)7-5-6-8-19-15(20)21-16(2,3)4/h5,7,9-10H,6,8,17-18H2,1-4H3,(H,19,20) |
| InChIKey | ZLDUPAYUFPGISD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|