C16H28N6O2 — CID 143569229
tert-butyl N-[3-[(6-amino-5-methanimidoylpyrimidin-4-yl)-propylamino]propyl]carbamate (PubChem CID 143569229) has the molecular formula C16H28N6O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is tert-butyl N-[3-[(6-amino-5-methanimidoylpyrimidin-4-yl)-propylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(6-amino-5-methanimidoylpyrimidin-4-yl)-propylamino]propyl]carbamate |
|---|---|
| PubChem CID | 143569229 |
| Molecular Formula | C16H28N6O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | tert-butyl N-[3-[(6-amino-5-methanimidoylpyrimidin-4-yl)-propylamino]propyl]carbamate |
| SMILES | [H]/N=C/c1c(N)ncnc1N(CCC)CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28N6O2/c1-5-8-22(14-12(10-17)13(18)20-11-21-14)9-6-7-19-15(23)24-16(2,3)4/h10-11,17H,5-9H2,1-4H3,(H,19,23)(H2,18,20,21)/b17-10+ |
| InChIKey | AZBTZFGEHIXILW-LICLKQGHSA-N |
| XLogP | 2.19 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|