C20H34N6O7 — CID 59359881
ethyl 2-[(6-amino-2-butoxy-5-nitropyrimidin-4-yl)-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]acetate (PubChem CID 59359881) has the molecular formula C20H34N6O7 and a molecular weight of 470.53 g/mol. Its IUPAC name is ethyl 2-[(6-amino-2-butoxy-5-nitropyrimidin-4-yl)-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]acetate.
| Compound Name | ethyl 2-[(6-amino-2-butoxy-5-nitropyrimidin-4-yl)-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]acetate |
|---|---|
| PubChem CID | 59359881 |
| Molecular Formula | C20H34N6O7 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | ethyl 2-[(6-amino-2-butoxy-5-nitropyrimidin-4-yl)-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]acetate |
| SMILES | CCCCOc1nc(N)c([N+](=O)[O-])c(N(CCCNC(=O)OC(C)(C)C)CC(=O)OCC)n1 |
| InChI | InChI=1S/C20H34N6O7/c1-6-8-12-32-18-23-16(21)15(26(29)30)17(24-18)25(13-14(27)31-7-2)11-9-10-22-19(28)33-20(3,4)5/h6-13H2,1-5H3,(H,22,28)(H2,21,23,24) |
| InChIKey | HBXGIVWQTHTYLX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 172.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|