C17H28N6O3 — CID 67262401
tert-butyl N-[3-(2-amino-6-butoxy-7H-purin-8-yl)propyl]carbamate (PubChem CID 67262401) has the molecular formula C17H28N6O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is tert-butyl N-[3-(2-amino-6-butoxy-7H-purin-8-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-amino-6-butoxy-7H-purin-8-yl)propyl]carbamate |
|---|---|
| PubChem CID | 67262401 |
| Molecular Formula | C17H28N6O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | tert-butyl N-[3-(2-amino-6-butoxy-7H-purin-8-yl)propyl]carbamate |
| SMILES | CCCCOc1nc(N)nc2nc(CCCNC(=O)OC(C)(C)C)[nH]c12 |
| InChI | InChI=1S/C17H28N6O3/c1-5-6-10-25-14-12-13(22-15(18)23-14)21-11(20-12)8-7-9-19-16(24)26-17(2,3)4/h5-10H2,1-4H3,(H,19,24)(H3,18,20,21,22,23) |
| InChIKey | QCJXRHHPXBIHOY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 128.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|