C20H37N5O3 — CID 90950205
tert-butyl N-[3-[2-amino-4-(1-hydroxyheptan-3-ylamino)-6-methylpyrimidin-5-yl]propyl]carbamate (PubChem CID 90950205) has the molecular formula C20H37N5O3 and a molecular weight of 395.55 g/mol. Its IUPAC name is tert-butyl N-[3-[2-amino-4-(1-hydroxyheptan-3-ylamino)-6-methylpyrimidin-5-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-amino-4-(1-hydroxyheptan-3-ylamino)-6-methylpyrimidin-5-yl]propyl]carbamate |
|---|---|
| PubChem CID | 90950205 |
| Molecular Formula | C20H37N5O3 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.29 |
| IUPAC Name | tert-butyl N-[3-[2-amino-4-(1-hydroxyheptan-3-ylamino)-6-methylpyrimidin-5-yl]propyl]carbamate |
| SMILES | CCCCC(CCO)Nc1nc(N)nc(C)c1CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H37N5O3/c1-6-7-9-15(11-13-26)24-17-16(14(2)23-18(21)25-17)10-8-12-22-19(27)28-20(3,4)5/h15,26H,6-13H2,1-5H3,(H,22,27)(H3,21,23,24,25) |
| InChIKey | LGVOGAVCCWZFCM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|