C13H20F3N5O2 — CID 175337404
tert-butyl N-[3-[2,6-diamino-5-(trifluoromethyl)pyrimidin-4-yl]propyl]carbamate (PubChem CID 175337404) has the molecular formula C13H20F3N5O2 and a molecular weight of 335.33 g/mol. Its IUPAC name is tert-butyl N-[3-[2,6-diamino-5-(trifluoromethyl)pyrimidin-4-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[2,6-diamino-5-(trifluoromethyl)pyrimidin-4-yl]propyl]carbamate |
|---|---|
| PubChem CID | 175337404 |
| Molecular Formula | C13H20F3N5O2 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | tert-butyl N-[3-[2,6-diamino-5-(trifluoromethyl)pyrimidin-4-yl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCc1nc(N)nc(N)c1C(F)(F)F |
| InChI | InChI=1S/C13H20F3N5O2/c1-12(2,3)23-11(22)19-6-4-5-7-8(13(14,15)16)9(17)21-10(18)20-7/h4-6H2,1-3H3,(H,19,22)(H4,17,18,20,21) |
| InChIKey | FWMICAUCDCJWKQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|