C12H17ClF3N5O2 — CID 39733654
tert-butyl N-[2-[[5-amino-6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]carbamate (PubChem CID 39733654) has the molecular formula C12H17ClF3N5O2 and a molecular weight of 355.75 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-amino-6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-amino-6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 39733654 |
| Molecular Formula | C12H17ClF3N5O2 |
| Molecular Weight | 355.75 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | tert-butyl N-[2-[[5-amino-6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1nc(C(F)(F)F)nc(Cl)c1N |
| InChI | InChI=1S/C12H17ClF3N5O2/c1-11(2,3)23-10(22)19-5-4-18-8-6(17)7(13)20-9(21-8)12(14,15)16/h4-5,17H2,1-3H3,(H,19,22)(H,18,20,21) |
| InChIKey | GWUCORIHOMFPPN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.75 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|