C14H23ClN4O2 — CID 114518265
tert-butyl N-[3-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]propyl]carbamate (PubChem CID 114518265) has the molecular formula C14H23ClN4O2 and a molecular weight of 314.82 g/mol. Its IUPAC name is tert-butyl N-[3-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 114518265 |
| Molecular Formula | C14H23ClN4O2 |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | tert-butyl N-[3-[(6-chloro-2,5-dimethylpyrimidin-4-yl)amino]propyl]carbamate |
| SMILES | Cc1nc(Cl)c(C)c(NCCCNC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C14H23ClN4O2/c1-9-11(15)18-10(2)19-12(9)16-7-6-8-17-13(20)21-14(3,4)5/h6-8H2,1-5H3,(H,17,20)(H,16,18,19) |
| InChIKey | YNKXDMKONKBHQD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|