C12H17ClN4O2S — CID 106595892
tert-butyl N-[3-[(4-chloro-5-cyano-1,3-thiazol-2-yl)amino]propyl]carbamate (PubChem CID 106595892) has the molecular formula C12H17ClN4O2S and a molecular weight of 316.81 g/mol. Its IUPAC name is tert-butyl N-[3-[(4-chloro-5-cyano-1,3-thiazol-2-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(4-chloro-5-cyano-1,3-thiazol-2-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 106595892 |
| Molecular Formula | C12H17ClN4O2S |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | tert-butyl N-[3-[(4-chloro-5-cyano-1,3-thiazol-2-yl)amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNc1nc(Cl)c(C#N)s1 |
| InChI | InChI=1S/C12H17ClN4O2S/c1-12(2,3)19-11(18)16-6-4-5-15-10-17-9(13)8(7-14)20-10/h4-6H2,1-3H3,(H,15,17)(H,16,18) |
| InChIKey | OHKGEUATLOFFTC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|