C16H27N7O4 — CID 70923387
tert-butyl N-[2-[[3,6-diamino-5-(propylcarbamoyl)pyrazine-2-carbonyl]amino]ethyl]carbamate (PubChem CID 70923387) has the molecular formula C16H27N7O4 and a molecular weight of 381.44 g/mol. Its IUPAC name is tert-butyl N-[2-[[3,6-diamino-5-(propylcarbamoyl)pyrazine-2-carbonyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3,6-diamino-5-(propylcarbamoyl)pyrazine-2-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 70923387 |
| Molecular Formula | C16H27N7O4 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | tert-butyl N-[2-[[3,6-diamino-5-(propylcarbamoyl)pyrazine-2-carbonyl]amino]ethyl]carbamate |
| SMILES | CCCNC(=O)c1nc(N)c(C(=O)NCCNC(=O)OC(C)(C)C)nc1N |
| InChI | InChI=1S/C16H27N7O4/c1-5-6-19-13(24)9-11(17)23-10(12(18)22-9)14(25)20-7-8-21-15(26)27-16(2,3)4/h5-8H2,1-4H3,(H2,17,23)(H2,18,22)(H,19,24)(H,20,25)(H,21,26) |
| InChIKey | XSDMFUOMDQSMPF-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 174.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|