C17H21ClN4O3S — CID 54433492
tert-butyl N-[2-[[2-amino-5-(4-chlorophenyl)-1,3-thiazole-4-carbonyl]amino]ethyl]carbamate (PubChem CID 54433492) has the molecular formula C17H21ClN4O3S and a molecular weight of 396.90 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-amino-5-(4-chlorophenyl)-1,3-thiazole-4-carbonyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-amino-5-(4-chlorophenyl)-1,3-thiazole-4-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 54433492 |
| Molecular Formula | C17H21ClN4O3S |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | tert-butyl N-[2-[[2-amino-5-(4-chlorophenyl)-1,3-thiazole-4-carbonyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)c1nc(N)sc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21ClN4O3S/c1-17(2,3)25-16(24)21-9-8-20-14(23)12-13(26-15(19)22-12)10-4-6-11(18)7-5-10/h4-7H,8-9H2,1-3H3,(H2,19,22)(H,20,23)(H,21,24) |
| InChIKey | WJDLYKHEHVGWPP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|