C13H20ClN6O2+ — CID 123452127
tert-butyl N-[3-(2-amino-6-chloro-7H-purin-3-ium-8-yl)propyl]carbamate (PubChem CID 123452127) has the molecular formula C13H20ClN6O2+ and a molecular weight of 327.80 g/mol. Its IUPAC name is tert-butyl N-[3-(2-amino-6-chloro-7H-purin-3-ium-8-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-amino-6-chloro-7H-purin-3-ium-8-yl)propyl]carbamate |
|---|---|
| PubChem CID | 123452127 |
| Molecular Formula | C13H20ClN6O2+ |
| Molecular Weight | 327.80 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | tert-butyl N-[3-(2-amino-6-chloro-7H-purin-3-ium-8-yl)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCc1nc2[nH+]c(N)nc(Cl)c2[nH]1 |
| InChI | InChI=1S/C13H19ClN6O2/c1-13(2,3)22-12(21)16-6-4-5-7-17-8-9(14)19-11(15)20-10(8)18-7/h4-6H2,1-3H3,(H,16,21)(H3,15,17,18,19,20)/p+1 |
| InChIKey | OEFNCZRPGLHHEW-UHFFFAOYSA-O |
| XLogP | 1.46 |
| TPSA | 120.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.80 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|