C22H35N5O8S — CID 178003324
tert-butyl N-[(E)-4-[4-carbamoyl-2-[3-(N-ethylperoxy-S-methylsulfinimidoyl)propoxy]-6-nitroanilino]but-2-enyl]carbamate (PubChem CID 178003324) has the molecular formula C22H35N5O8S and a molecular weight of 529.62 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-[4-carbamoyl-2-[3-(N-ethylperoxy-S-methylsulfinimidoyl)propoxy]-6-nitroanilino]but-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-4-[4-carbamoyl-2-[3-(N-ethylperoxy-S-methylsulfinimidoyl)propoxy]-6-nitroanilino]but-2-enyl]carbamate |
|---|---|
| PubChem CID | 178003324 |
| Molecular Formula | C22H35N5O8S |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | tert-butyl N-[(E)-4-[4-carbamoyl-2-[3-(N-ethylperoxy-S-methylsulfinimidoyl)propoxy]-6-nitroanilino]but-2-enyl]carbamate |
| SMILES | CCOON=S(C)CCCOc1cc(C(N)=O)cc([N+](=O)[O-])c1NC/C=C/CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H35N5O8S/c1-6-33-35-26-36(5)13-9-12-32-18-15-16(20(23)28)14-17(27(30)31)19(18)24-10-7-8-11-25-21(29)34-22(2,3)4/h7-8,14-15,24H,6,9-13H2,1-5H3,(H2,23,28)(H,25,29)/b8-7+ |
| InChIKey | FABFXACPADPQTK-BQYQJAHWSA-N |
| XLogP | 3.27 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|