C21H32N2O4 — CID 157156120
tert-butyl N-[(E)-5-(2-butoxy-4-carbamoylphenyl)pent-2-enyl]carbamate (PubChem CID 157156120) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is tert-butyl N-[(E)-5-(2-butoxy-4-carbamoylphenyl)pent-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-5-(2-butoxy-4-carbamoylphenyl)pent-2-enyl]carbamate |
|---|---|
| PubChem CID | 157156120 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | tert-butyl N-[(E)-5-(2-butoxy-4-carbamoylphenyl)pent-2-enyl]carbamate |
| SMILES | CCCCOc1cc(C(N)=O)ccc1CC/C=C/CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H32N2O4/c1-5-6-14-26-18-15-17(19(22)24)12-11-16(18)10-8-7-9-13-23-20(25)27-21(2,3)4/h7,9,11-12,15H,5-6,8,10,13-14H2,1-4H3,(H2,22,24)(H,23,25)/b9-7+ |
| InChIKey | CMOKQZPEKUOZOP-VQHVLOKHSA-N |
| XLogP | 3.98 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|